4-Biphenylsulfonyl chloride, 95%
cas: 1623-93-4 — see every product listed under this CAS number, including other names
4-Biphenylsulfonyl chloride, 95% (CAS 1623-93-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5g, 10g, 25g, 1g, 100g, 500g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A147186-1mg |
| cas | 1623-93-4 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 125.62 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Fluorochem | 1g | 102.06 Pln | |
| Fluorochem | 5g | 102.06 Pln | |
| Fluorochem | 10g | 117.68 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 461.31 Pln | |
| Fluorochem | 500g | 1414.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-phenylbenzenesulfonyl chloride (CAS 1623-93-4) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 4-phenylbenzenesulfonyl chloride. InChIKey: ALBQXDHCMLLQMB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 4-phenylbenzenesulfonyl chloride |
| InChIKey | ALBQXDHCMLLQMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Biphenyl]-4-sulfonyl chloride, (1,1'-Biphenyl)-4-sulphonyl chloride, (1,1'-Biphenyl)-4-sulfonyl chloride, [1,1'-biphenyl]-4-sulphonyl chloride, 4-Biphenylsulfonyl Chloride, Biphenyl-4-sulfonyl chloride, 4-Phenylbenzenesulfonyl chloride, C12H9ClO2S, 4-(Chlorosulfonyl)biphenyl, [1,1'-biphenyl]-4-sulfonylchloride