cas: 153039-17-9 — see every product listed under this CAS number, including other names
4-Boc-amino-2,2-dimethylbutyric acid 99% (CAS 153039-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A276350-100mg |
| cas | 153039-17-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 431.56 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1249.25 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A276350 |
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 153039-17-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: TWMVVJUXUMIAAJ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | TWMVVJUXUMIAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)