cas: 953421-74-4 — see every product listed under this CAS number, including other names
4-Bromo-1,7-dichloro-isoquinoline, 97%, 97% (CAS 953421-74-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILZP-50mg |
| cas | 953421-74-4 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 256.40 Pln | |
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 1g | 3866.00 Pln | |
| Chemat | 5g | 16979.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1,7-dichloroisoquinoline (CAS 953421-74-4) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 4-bromo-1,7-dichloroisoquinoline. InChIKey: MPNVIJOSWLWNKA-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 4-bromo-1,7-dichloroisoquinoline |
| InChIKey | MPNVIJOSWLWNKA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NC=C2Br)Cl |
Computed by PubChem (NCBI)