cas: 943749-63-1 — see every product listed under this CAS number, including other names
4-Bromo-2-(carboxymethyl)benzoic acid 95% (CAS 943749-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A702229-100mg |
| cas | 943749-63-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1238.12 Pln | |
| Ambeed | 5g | 4130.62 Pln | |
| Ambeed | 10g | 7373.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A702229 |
4-bromo-2-(carboxymethyl)benzoic acid (CAS 943749-63-1) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 4-bromo-2-(carboxymethyl)benzoic acid. InChIKey: WDKVNGVXRHWUEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 4-bromo-2-(carboxymethyl)benzoic acid |
| InChIKey | WDKVNGVXRHWUEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)