cas: 943749-63-1 — see every product listed under this CAS number, including other names
4-Bromo-2-(carboxymethyl)benzoic acid, 97%, 97% (CAS 943749-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11II4L-100mg |
| cas | 943749-63-1 |
| size | 100mg |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 856.40 Pln | |
| Chemat | 5g | 2843.60 Pln | |
| Chemat | 10g | 5070.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-(carboxymethyl)benzoic acid (CAS 943749-63-1) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 4-bromo-2-(carboxymethyl)benzoic acid. InChIKey: WDKVNGVXRHWUEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 4-bromo-2-(carboxymethyl)benzoic acid |
| InChIKey | WDKVNGVXRHWUEQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)