cas: 355423-16-4 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-5-nitrobenzoic acid 98% (CAS 355423-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A627223-100mg |
| cas | 355423-16-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Ambeed | 25g | 1277.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A627223 |
4-bromo-2-fluoro-5-nitrobenzoic acid (CAS 355423-16-4) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-2-fluoro-5-nitrobenzoic acid. InChIKey: OGSIBDAVDNXXMS-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-nitrobenzoic acid |
| InChIKey | OGSIBDAVDNXXMS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)C(=O)O |
Computed by PubChem (NCBI)