4-Bromo-2-fluoro-5-nitrobenzoic acid, 97%
cas: 355423-16-4 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-5-nitrobenzoic acid, 97% (CAS 355423-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F641051-100MG |
| cas | 355423-16-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 500mg | 185.37 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 2.5g | 216.61 Pln | |
| Fluorochem | 5g | 372.80 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1289.15 Pln | |
| Fluorochem | 100g | 3366.54 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 500mg | 117.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 813.20 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-bromo-2-fluoro-5-nitrobenzoic acid (CAS 355423-16-4) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 4-bromo-2-fluoro-5-nitrobenzoic acid. InChIKey: OGSIBDAVDNXXMS-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-nitrobenzoic acid |
| InChIKey | OGSIBDAVDNXXMS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-bromo-2-fluoro-5-nitro-benzoic Acid