cas: 326595-66-8 — see every product listed under this CAS number, including other names
4-Bromo-3-nitrobenzyl bromide, 95% (CAS 326595-66-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036974-250MG |
| cas | 326595-66-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 815.36 Pln | |
| Fluorochem | 25g | 1632.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-4-(bromomethyl)-2-nitrobenzene (CAS 326595-66-8) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1-bromo-4-(bromomethyl)-2-nitrobenzene. InChIKey: PXAIZWVEYHNBLL-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1-bromo-4-(bromomethyl)-2-nitrobenzene |
| InChIKey | PXAIZWVEYHNBLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)