4-Chloro-1H-indole-3-carboxylic acid, 95%
cas: 23872-36-8 — see every product listed under this CAS number, including other names
4-Chloro-1H-indole-3-carboxylic acid, 95% (CAS 23872-36-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A292810-250mg |
| cas | 23872-36-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 971.12 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 5g | 808.40 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 1041.88 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 289.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-1H-indole-3-carboxylic acid (CAS 23872-36-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 4-chloro-1H-indole-3-carboxylic acid. InChIKey: DRKHLIJRUYVIOY-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-chloro-1H-indole-3-carboxylic acid |
| InChIKey | DRKHLIJRUYVIOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)