cas: 98187-13-4 — see every product listed under this CAS number, including other names
4-Chloro-2-(trifluoromethyl)benzoyl chloride 98+% (CAS 98187-13-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A496192-250mg |
| cas | 98187-13-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1193.62 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A496192 |
4-chloro-2-(trifluoromethyl)benzoyl chloride (CAS 98187-13-4) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzoyl chloride. InChIKey: SBWSLWFNEXVAAY-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)benzoyl chloride |
| InChIKey | SBWSLWFNEXVAAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)