cas: 261763-23-9 — see every product listed under this CAS number, including other names
4-Chloro-3-(trifluoromethyl)benzyl bromide, 98% (CAS 261763-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005719-250MG |
| cas | 261763-23-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1060.06 Pln | |
| Fluorochem | 25g | 3330.10 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-(bromomethyl)-1-chloro-2-(trifluoromethyl)benzene (CAS 261763-23-9) is a chemical compound with the molecular formula C8H5BrClF3 and a molecular weight of 273.48 g/mol. IUPAC name: 4-(bromomethyl)-1-chloro-2-(trifluoromethyl)benzene. InChIKey: LZLIPLUATRVXSB-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClF3 |
|---|---|
| Molecular weight | 273.48 g/mol |
| IUPAC name | 4-(bromomethyl)-1-chloro-2-(trifluoromethyl)benzene |
| InChIKey | LZLIPLUATRVXSB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)C(F)(F)F)Cl |
Computed by PubChem (NCBI)