4-Chloro-4'-methyl-1,1'-biphenyl, 95%
cas: 19482-11-2 — see every product listed under this CAS number, including other names
4-Chloro-4'-methyl-1,1'-biphenyl, 95% (CAS 19482-11-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A637017-250mg |
| cas | 19482-11-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 2283.88 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 798.80 Pln | |
| Chemat | 5g | 3002.00 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 286.59 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| BLDpharm | 5g | 2452.49 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-chloro-4-(4-methylphenyl)benzene (CAS 19482-11-2) is a chemical compound with the molecular formula C13H11Cl and a molecular weight of 202.68 g/mol. IUPAC name: 1-chloro-4-(4-methylphenyl)benzene. InChIKey: XYOKCUNCQZYSPK-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 1-chloro-4-(4-methylphenyl)benzene |
| InChIKey | XYOKCUNCQZYSPK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)