4-Chloro-5,6-difluoronicotinic acid, 95%
cas: 851386-32-8 — see every product listed under this CAS number, including other names
4-Chloro-5,6-difluoronicotinic acid, 95% (CAS 851386-32-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F214662-250MG |
| cas | 851386-32-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 2111.77 Pln | |
| Fluorochem | 10g | 4085.04 Pln | |
| Fluorochem | 25g | 7953.47 Pln | |
| Ambeed | 5g | 2055.81 Pln | |
| Ambeed | 10g | 4036.06 Pln | |
| Ambeed | 25g | 9014.50 Pln | |
| Ambeed | 100g | 28689.06 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 526.12 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-chloro-5,6-difluoropyridine-3-carboxylic acid (CAS 851386-32-8) is a chemical compound with the molecular formula C6H2ClF2NO2 and a molecular weight of 193.53 g/mol. IUPAC name: 4-chloro-5,6-difluoropyridine-3-carboxylic acid. InChIKey: SQMYITSFQKNMHA-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO2 |
|---|---|
| Molecular weight | 193.53 g/mol |
| IUPAC name | 4-chloro-5,6-difluoropyridine-3-carboxylic acid |
| InChIKey | SQMYITSFQKNMHA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)