cas: 1226804-02-9 — see every product listed under this CAS number, including other names
4-Chloro-5,7-Dihydro-5,5-Dimethyl-6H-Pyrrolo[2,3-D]Pyrimidin-6-One, 97%, 97% (CAS 1226804-02-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 25g, 100g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1128MD-500mg |
| cas | 1226804-02-9 |
| size | 500mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 323.60 Pln | |
| Chemat | 25g | 4960.40 Pln | |
| Chemat | 100g | 14757.20 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1509.20 Pln | |
| Chemat | 10g | 2488.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (CAS 1226804-02-9) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 4-chloro-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one. InChIKey: KYBINFJRIXEZGI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-chloro-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| InChIKey | KYBINFJRIXEZGI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(NC1=O)N=CN=C2Cl)C |
Computed by PubChem (NCBI)