CAS 1932556-56-3 is the registry number for (S)-4-Chloro-5-methyl-5,6-dihydropyrido[2,3-d]pyrimidin-7(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-4-chloro-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (CAS 1932556-56-3) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: (5S)-4-chloro-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one. InChIKey: HGBDGFXWZDTFEB-BYPYZUCNSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (5S)-4-chloro-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | HGBDGFXWZDTFEB-BYPYZUCNSA-N |
| SMILES | C[C@H]1CC(=O)NC2=C1C(=NC=N2)Cl |
Computed by PubChem (NCBI)