CAS 1226804-02-9 appears in our catalog under these names: 4-Chloro-5,5-dimethyl-5h,6h,7h-pyrrolo[2,3-d]pyrimidin-6-one, 95%, 4-Chloro-5,5-dimethyl-5H-pyrrolo[2,3-d]pyrimidin-6(7H)-one 97%, 4-Chloro-5,7-Dihydro-5,5-Dimethyl-6H-Pyrrolo[2,3-D]Pyrimidin-6-One, 97%, 97%, 4-CHLORO-5,5-DIMETHYL-5H,6H,7H-PYRROLO[2,3-D]PYRIMIDIN-6-ONE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 500mg, 100g, 100mg.
4-chloro-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (CAS 1226804-02-9) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 4-chloro-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one. InChIKey: KYBINFJRIXEZGI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-chloro-5,5-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| InChIKey | KYBINFJRIXEZGI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(NC1=O)N=CN=C2Cl)C |
Computed by PubChem (NCBI)