CAS 1312949-23-7 is the registry number for 3-Chloro-1,4-dimethyl-1h,6h,7h-pyrazolo[3,4-b]pyridin-6-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
3-chloro-1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (CAS 1312949-23-7) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 3-chloro-1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one. InChIKey: UHBJOGIIZPFFHO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 3-chloro-1,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| InChIKey | UHBJOGIIZPFFHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C(=NN2C)Cl |
Computed by PubChem (NCBI)