CAS 117052-60-5 appears in our catalog under these names: 6-Chloro-2-ethoxyimidazo[1,2-b]pyridazine, 95%, 6-Chloro-2-ethoxyimidazo(1,2-b)pyridazine, 95%, 6–Chloro–2–ethoxyimidazo(1,2–b)pyridazine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-chloro-2-ethoxyimidazo[1,2-b]pyridazine (CAS 117052-60-5) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 6-chloro-2-ethoxyimidazo[1,2-b]pyridazine. InChIKey: SBKGKTKQPOCZBI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 6-chloro-2-ethoxyimidazo[1,2-b]pyridazine |
| InChIKey | SBKGKTKQPOCZBI-UHFFFAOYSA-N |
| SMILES | CCOC1=CN2C(=N1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)