CAS 952938-62-4 is the registry number for 5-(Chloromethyl)-2-methylpyrazolo[1,5-a]pyrimidin-7(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
5-(chloromethyl)-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 952938-62-4) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 5-(chloromethyl)-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: JAYNBPKIWPWGQB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 5-(chloromethyl)-2-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | JAYNBPKIWPWGQB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CC(=O)N2N1)CCl |
Computed by PubChem (NCBI)