Products 1177447-31-2
CAS 1177447-31-2 appears in our catalog under these names: 4-Chloro-5-methyl-5,6-dihydropyrido[2,3-d]pyrimidin-7(8h)-one, 95%, 4-Chloro-5-methyl-5,6-dihydropyrido(2,3-d)pyrimidin-7(8H)-one, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-chloro-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (CAS 1177447-31-2) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 4-chloro-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one. InChIKey: HGBDGFXWZDTFEB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-chloro-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | HGBDGFXWZDTFEB-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)NC2=C1C(=NC=N2)Cl |
Computed by PubChem (NCBI)