CAS 1865223-60-4 appears in our catalog under these names: 4-Cyanobenzohydrazide hydrochloride, 95%, 4-Cyanobenzohydrazide hydrochloride, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 25g.
4-cyanobenzohydrazide;hydrochloride (CAS 1865223-60-4) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 4-cyanobenzohydrazide;hydrochloride. InChIKey: FHQWCOSUUVDSKK-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-cyanobenzohydrazide;hydrochloride |
| InChIKey | FHQWCOSUUVDSKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(=O)NN.Cl |
Computed by PubChem (NCBI)