CAS 1803608-48-1 is the registry number for 4-(1,2,4-oxadiazol-3-yl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
4-(1,2,4-oxadiazol-3-yl)aniline;hydrochloride (CAS 1803608-48-1) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 4-(1,2,4-oxadiazol-3-yl)aniline;hydrochloride. InChIKey: SHDLKFDHTNZDBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-(1,2,4-oxadiazol-3-yl)aniline;hydrochloride |
| InChIKey | SHDLKFDHTNZDBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC=N2)N.Cl |
Computed by PubChem (NCBI)