cas: 346-34-9 — see every product listed under this CAS number, including other names
4-Fluoroindoline-2,3-dione 95% (CAS 346-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215922-100mg |
| cas | 346-34-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 737.50 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A215922 |
4-fluoro-1H-indole-2,3-dione (CAS 346-34-9) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 4-fluoro-1H-indole-2,3-dione. InChIKey: VUPIFURSDLGPMH-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 4-fluoro-1H-indole-2,3-dione |
| InChIKey | VUPIFURSDLGPMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)