cas: 98995-40-5 — see every product listed under this CAS number, including other names
4-Isopropoxybenzene-1-sulfonyl chloride, 98% (CAS 98995-40-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A935406-10g |
| cas | 98995-40-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 662.41 Pln | |
| AmBeed | 1g | 239.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-propan-2-yloxybenzenesulfonyl chloride (CAS 98995-40-5) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-propan-2-yloxybenzenesulfonyl chloride. InChIKey: IJWCRHKAQNFJLT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-propan-2-yloxybenzenesulfonyl chloride |
| InChIKey | IJWCRHKAQNFJLT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)