cas: 98995-40-5 — see every product listed under this CAS number, including other names
4-Isopropoxybenzenesulfonyl Chloride, >98.0%(GC) (CAS 98995-40-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0802-5G |
| cas | 98995-40-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 513.21 Pln | |
| TCI | 25g | 1417.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
4-propan-2-yloxybenzenesulfonyl chloride (CAS 98995-40-5) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-propan-2-yloxybenzenesulfonyl chloride. InChIKey: IJWCRHKAQNFJLT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-propan-2-yloxybenzenesulfonyl chloride |
| InChIKey | IJWCRHKAQNFJLT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)