cas: 2022984-58-1 — see every product listed under this CAS number, including other names
4-Methoxycarbonyl-2,6-difluorophenylboronic acid 96% (CAS 2022984-58-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A823417-250mg |
| cas | 2022984-58-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A823417 |
(2,6-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 2022984-58-1) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: UAQVWIOVTATRBS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | UAQVWIOVTATRBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)