cas: 2022984-58-1 — see every product listed under this CAS number, including other names
4-Methoxycarbonyl-2,6-difluorophenylboronic acid, 97%, 97% (CAS 2022984-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I4SG-100mg |
| cas | 2022984-58-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 645.20 Pln | |
| Chemat | 5g | 1888.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,6-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 2022984-58-1) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: UAQVWIOVTATRBS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | UAQVWIOVTATRBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)