cas: 959-33-1 — see every product listed under this CAS number, including other names
4-Methoxychalcone, 98%, 98% (CAS 959-33-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJI0-5g |
| cas | 959-33-1 |
| size | 5g |
| availability | 680g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Chemat | 100g | 669.20 Pln | |
| Chemat | 500g | 2649.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one (CAS 959-33-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: XUFXKBJMCRJATM-FMIVXFBMSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | XUFXKBJMCRJATM-FMIVXFBMSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)