cas: 59020-45-0 — see every product listed under this CAS number, including other names
4-Pyridin-2-yl-thiazole-2-carboxylic acid, 98%, 98% (CAS 59020-45-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EA15-100mg |
| cas | 59020-45-0 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 774.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-pyridin-2-yl-1,3-thiazole-2-carboxylic acid (CAS 59020-45-0) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 4-pyridin-2-yl-1,3-thiazole-2-carboxylic acid. InChIKey: SQXPZNRYQFUOOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 4-pyridin-2-yl-1,3-thiazole-2-carboxylic acid |
| InChIKey | SQXPZNRYQFUOOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)