CAS 1174322-64-5 appears in our catalog under these names: 5-(1,3-Thiazol-2-yl)pyridine-2-carboxylic acid, 95%, 5-(Thiazol-2-yl)picolinic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
5-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid (CAS 1174322-64-5) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 5-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid. InChIKey: WYXFCAVXHLKGLU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 5-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid |
| InChIKey | WYXFCAVXHLKGLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=NC=CS2)C(=O)O |
Computed by PubChem (NCBI)