CAS 1353723-60-0 is the registry number for 3-Phenyl-1,2,4-thiadiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
3-phenyl-1,2,4-thiadiazole-5-carboxylic acid (CAS 1353723-60-0) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 3-phenyl-1,2,4-thiadiazole-5-carboxylic acid. InChIKey: ALLQWDLQIJYVAH-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 3-phenyl-1,2,4-thiadiazole-5-carboxylic acid |
| InChIKey | ALLQWDLQIJYVAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)C(=O)O |
Computed by PubChem (NCBI)