Products 1353723-60-0

CAS 1353723-60-0 is the registry number for 3-Phenyl-1,2,4-thiadiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-phenyl-1,2,4-thiadiazole-5-carboxylic acid (CAS 1353723-60-0) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 3-phenyl-1,2,4-thiadiazole-5-carboxylic acid. InChIKey: ALLQWDLQIJYVAH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O2S
Molecular weight206.22 g/mol
IUPAC name3-phenyl-1,2,4-thiadiazole-5-carboxylic acid
InChIKeyALLQWDLQIJYVAH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NSC(=N2)C(=O)O

Computed by PubChem (NCBI)