CAS 115311-41-6 appears in our catalog under these names: 2-(Pyridin-2-yl)-1,3-thiazole-4-carboxylic acid, 98%, Sodium 2-pyridin-2-yl-1,3-thiazole-4-carboxylate, 95%, 2-Pyridin-2-yl-1,3-thiazole-4-carboxylic acid, 98%, 2-Pyridin-2-yl-1,3-thiazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 25g, 250mg, 5g, 1g, 100g.
2-pyridin-2-yl-1,3-thiazole-4-carboxylic acid (CAS 115311-41-6) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-pyridin-2-yl-1,3-thiazole-4-carboxylic acid. InChIKey: KJHHLEKGRGFSQH-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-pyridin-2-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | KJHHLEKGRGFSQH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)