CAS 105361-75-9 appears in our catalog under these names: 2-(3-Nitrophenyl)-1,3-thiazole, 95%, 2-(3-Nitrophenyl)-1,3-thiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(3-nitrophenyl)-1,3-thiazole (CAS 105361-75-9) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-(3-nitrophenyl)-1,3-thiazole. InChIKey: ITKRJFNDXYFPNU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1,3-thiazole |
| InChIKey | ITKRJFNDXYFPNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC=CS2 |
Computed by PubChem (NCBI)