CAS 916766-97-7 appears in our catalog under these names: 2-Thien-2-ylpyrimidine-5-carboxylic acid, 95%, 2-Thien-2-ylpyrimidine-5-carboxylic acid, 97% , 2-(Thiophen-2-yl)pyrimidine-5-carboxylic acid 95%, 2-Thien-2-ylpyrimidine-5-carboxylic acid, 95%, 95%, 2-(THIOPHEN-2-YL)PYRIMIDINE-5-CARBOXYLIC ACID, 95%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-thiophen-2-ylpyrimidine-5-carboxylic acid (CAS 916766-97-7) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-thiophen-2-ylpyrimidine-5-carboxylic acid. InChIKey: SJJLOOUOVNRKLF-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-thiophen-2-ylpyrimidine-5-carboxylic acid |
| InChIKey | SJJLOOUOVNRKLF-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)