CAS 248275-42-5 appears in our catalog under these names: 2-Pyridin-3-yl-thiazole-5-carboxylic acid, 95%, 2-(Pyridin-3-yl)-1,3-thiazole-5-carboxylic acid, 2-(Pyridin-3-yl)thiazole-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg.
2-pyridin-3-yl-1,3-thiazole-5-carboxylic acid (CAS 248275-42-5) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-pyridin-3-yl-1,3-thiazole-5-carboxylic acid. InChIKey: WYKOXFDRTSNVGV-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-pyridin-3-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WYKOXFDRTSNVGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)