CAS 59020-45-0 appears in our catalog under these names: 4-Pyridin-2-yl-thiazole-2-carboxylic acid, 95%, 4-Pyridin-2-yl-thiazole-2-carboxylic acid, 98%, 98%, 4-(2-PYRIDINYL)-THIAZOLE-2-CARBOXYLIC ACID, 98%, 4-(Pyridin-2-yl)thiazole-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
4-pyridin-2-yl-1,3-thiazole-2-carboxylic acid (CAS 59020-45-0) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 4-pyridin-2-yl-1,3-thiazole-2-carboxylic acid. InChIKey: SQXPZNRYQFUOOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 4-pyridin-2-yl-1,3-thiazole-2-carboxylic acid |
| InChIKey | SQXPZNRYQFUOOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)