CAS 3704-41-4 appears in our catalog under these names: 2–(4–Nitrophenyl)thiazole, 2-(4-Nitrophenyl)thiazole, 95%, 2-(4-Nitrophenyl)-1,3-thiazole, 95%. Offered by: GLPBio, AmBeed, Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
2-(4-nitrophenyl)-1,3-thiazole (CAS 3704-41-4) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-thiazole. InChIKey: LGDOGDJADXLHLA-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-thiazole |
| InChIKey | LGDOGDJADXLHLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CS2)[N+](=O)[O-] |
Computed by PubChem (NCBI)