5,6-Dibromonicotinic acid, 97%
cas: 29241-64-3 — see every product listed under this CAS number, including other names
5,6-Dibromonicotinic acid, 97% (CAS 29241-64-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045310-1G |
| cas | 29241-64-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 404.04 Pln | |
| Fluorochem | 25g | 893.45 Pln | |
| Fluorochem | 100g | 3345.71 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5,6-dibromopyridine-3-carboxylic acid (CAS 29241-64-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 5,6-dibromopyridine-3-carboxylic acid. InChIKey: ABBCIGFWDCOGEQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 5,6-dibromopyridine-3-carboxylic acid |
| InChIKey | ABBCIGFWDCOGEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)