cas: 1206679-66-4 — see every product listed under this CAS number, including other names
5,6-Dibromopicolinic acid, 95% (CAS 1206679-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212747-100MG |
| cas | 1206679-66-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2497.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5,6-dibromopyridine-2-carboxylic acid (CAS 1206679-66-4) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 5,6-dibromopyridine-2-carboxylic acid. InChIKey: XKHFYQMPUZAWOA-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 5,6-dibromopyridine-2-carboxylic acid |
| InChIKey | XKHFYQMPUZAWOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)