5,6-Difluoroisoindoline hydrochloride, 97%
cas: 1820619-19-9 — see every product listed under this CAS number, including other names
5,6-Difluoroisoindoline hydrochloride, 97% (CAS 1820619-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A406721-250mg |
| cas | 1820619-19-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1115.75 Pln | |
| Ambeed | 1g | 2890.19 Pln | |
| Ambeed | 5g | 9943.44 Pln | |
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 1g | 2046.80 Pln | |
| Chemat | 5g | 8723.60 Pln | |
| BLDpharm | 100mg | 736.43 Pln | |
| BLDpharm | 250mg | 1197.38 Pln | |
| BLDpharm | 1g | 3113.37 Pln | |
| BLDpharm | 5g | 10716.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride (CAS 1820619-19-9) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: CKWVOHSNYJQGBF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | CKWVOHSNYJQGBF-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2CN1)F)F.Cl |
Computed by PubChem (NCBI)
