CAS 1780205-32-4 is the registry number for 2-Chloro-5-(1,1-difluoroethyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-5-(1,1-difluoroethyl)aniline (CAS 1780205-32-4) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 2-chloro-5-(1,1-difluoroethyl)aniline. InChIKey: PVRAJKMEAZJTMM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 2-chloro-5-(1,1-difluoroethyl)aniline |
| InChIKey | PVRAJKMEAZJTMM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)Cl)N)(F)F |
Computed by PubChem (NCBI)