CAS 1955553-08-8 is the registry number for 4,7-Difluoro-2,3-dihydro-1H-isoindole hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,7-difluoro-2,3-dihydro-1H-isoindole;hydrochloride (CAS 1955553-08-8) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 4,7-difluoro-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: DHEBQVULSXLMDF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 4,7-difluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | DHEBQVULSXLMDF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2CN1)F)F.Cl |
Computed by PubChem (NCBI)