CAS 1271477-83-8 is the registry number for 1-(3-Chlorophenyl)-2,2-difluoroethan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3-chlorophenyl)-2,2-difluoroethanamine (CAS 1271477-83-8) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 1-(3-chlorophenyl)-2,2-difluoroethanamine. InChIKey: KOJQEJSVBLTNMP-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2,2-difluoroethanamine |
| InChIKey | KOJQEJSVBLTNMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(F)F)N |
Computed by PubChem (NCBI)