CAS 2763538-19-6 is the registry number for 4-Chloro-3,5-difluoro-2,6-dimethylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3,5-difluoro-2,6-dimethylaniline (CAS 2763538-19-6) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 4-chloro-3,5-difluoro-2,6-dimethylaniline. InChIKey: RTASRQWLEACKFM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 4-chloro-3,5-difluoro-2,6-dimethylaniline |
| InChIKey | RTASRQWLEACKFM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)Cl)F)C)N |
Computed by PubChem (NCBI)