CAS 1803601-85-5 appears in our catalog under these names: 4,6-Difluoro-2,3-dihydro-1h-indole hydrochloride, 95%, 4,6-Difluoroindoline hydrochloride, 95%, 4,6–Difluoroindoline hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
4,6-difluoro-2,3-dihydro-1H-indole;hydrochloride (CAS 1803601-85-5) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 4,6-difluoro-2,3-dihydro-1H-indole;hydrochloride. InChIKey: NDOHUXUMZLPCPV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 4,6-difluoro-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | NDOHUXUMZLPCPV-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)