CAS 2607141-43-3 is the registry number for 2-Chloro-4-(1,1-difluoroethyl)-6-methylpyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-(1,1-difluoroethyl)-6-methylpyridine (CAS 2607141-43-3) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 2-chloro-4-(1,1-difluoroethyl)-6-methylpyridine. InChIKey: WRDQSTSYWGBBOX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 2-chloro-4-(1,1-difluoroethyl)-6-methylpyridine |
| InChIKey | WRDQSTSYWGBBOX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)Cl)C(C)(F)F |
Computed by PubChem (NCBI)