Products 1269983-63-2
CAS 1269983-63-2 is the registry number for (R)-1-(4-Chloro-2,5-difluorophenyl)ethan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4-chloro-2,5-difluorophenyl)ethanamine (CAS 1269983-63-2) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: (1R)-1-(4-chloro-2,5-difluorophenyl)ethanamine. InChIKey: VIDPJIAQADUIJC-SCSAIBSYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | (1R)-1-(4-chloro-2,5-difluorophenyl)ethanamine |
| InChIKey | VIDPJIAQADUIJC-SCSAIBSYSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1F)Cl)F)N |
Computed by PubChem (NCBI)