Products 1820619-19-9
CAS 1820619-19-9 appears in our catalog under these names: 5,6-Difluoro-2,3-dihydro-1H-isoindole hydrochloride, 5,6-Difluoroisoindoline hydrochloride 97%, 5,6-Difluoroisoindoline hydrochloride, 97%, 97%, 5,6-Difluoroisoindoline hydrochloride, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 500mg, 10g.
5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride (CAS 1820619-19-9) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: 5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: CKWVOHSNYJQGBF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | 5,6-difluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | CKWVOHSNYJQGBF-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2CN1)F)F.Cl |
Computed by PubChem (NCBI)