cas: 4792-71-6 — see every product listed under this CAS number, including other names
5,7-Dichloro-1H-indole-2-carboxylic acid, ≥97-<99% (CAS 4792-71-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC770-97-99-25g |
| cas | 4792-71-6 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 4563.46 Pln | |
| Hoffman Fine Chemicals | 50g | 7115.46 Pln | |
| Hoffman Fine Chemicals | 100g | 11205.04 Pln | |
| Hoffman Fine Chemicals | 200g | 17744.54 Pln | |
| Hoffman Fine Chemicals | 300g | 21228.02 Pln | |
| Hoffman Fine Chemicals | 400g | 24009.70 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
5,7-dichloro-1H-indole-2-carboxylic acid (CAS 4792-71-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: QILAXMNESNFYJG-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | QILAXMNESNFYJG-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)