cas: 4792-71-6 — see every product listed under this CAS number, including other names
5,7-Dichloro-indole-2-carboxylic acid, 98% (CAS 4792-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049478-250MG |
| cas | 4792-71-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 456.11 Pln | |
| Fluorochem | 10g | 857.01 Pln | |
| Fluorochem | 25g | 2059.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5,7-dichloro-1H-indole-2-carboxylic acid (CAS 4792-71-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 5,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: QILAXMNESNFYJG-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | QILAXMNESNFYJG-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)